C13H17Br2NO3S — CID 80708119
4-(2,5-dibromo-4-methylphenyl)sulfonyl-2-methyl-1,4-oxazepane (PubChem CID 80708119) has the molecular formula C13H17Br2NO3S and a molecular weight of 427.16 g/mol. Its IUPAC name is 4-(2,5-dibromo-4-methylphenyl)sulfonyl-2-methyl-1,4-oxazepane.
| Compound Name | 4-(2,5-dibromo-4-methylphenyl)sulfonyl-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 80708119 |
| Molecular Formula | C13H17Br2NO3S |
| Molecular Weight | 427.16 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | 4-(2,5-dibromo-4-methylphenyl)sulfonyl-2-methyl-1,4-oxazepane |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2CCCOC(C)C2)cc1Br |
| InChI | InChI=1S/C13H17Br2NO3S/c1-9-6-12(15)13(7-11(9)14)20(17,18)16-4-3-5-19-10(2)8-16/h6-7,10H,3-5,8H2,1-2H3 |
| InChIKey | KFHBUQUHAUCLDZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.16 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |