C14H19BrClNO3S — CID 114363592
4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2-methyl-1,4-oxazepane (PubChem CID 114363592) has the molecular formula C14H19BrClNO3S and a molecular weight of 396.73 g/mol. Its IUPAC name is 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2-methyl-1,4-oxazepane.
| Compound Name | 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 114363592 |
| Molecular Formula | C14H19BrClNO3S |
| Molecular Weight | 396.73 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 4-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-2-methyl-1,4-oxazepane |
| SMILES | Cc1cc(CCl)cc(S(=O)(=O)N2CCCOC(C)C2)c1Br |
| InChI | InChI=1S/C14H19BrClNO3S/c1-10-6-12(8-16)7-13(14(10)15)21(18,19)17-4-3-5-20-11(2)9-17/h6-7,11H,3-5,8-9H2,1-2H3 |
| InChIKey | ZCOFWFRLNRWPJB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.73 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|