C15H21BrClNO2S — CID 114363641
1-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-3,3-dimethylpiperidine (PubChem CID 114363641) has the molecular formula C15H21BrClNO2S and a molecular weight of 394.76 g/mol. Its IUPAC name is 1-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-3,3-dimethylpiperidine.
| Compound Name | 1-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 114363641 |
| Molecular Formula | C15H21BrClNO2S |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 1-[2-bromo-5-(chloromethyl)-3-methylphenyl]sulfonyl-3,3-dimethylpiperidine |
| SMILES | Cc1cc(CCl)cc(S(=O)(=O)N2CCCC(C)(C)C2)c1Br |
| InChI | InChI=1S/C15H21BrClNO2S/c1-11-7-12(9-17)8-13(14(11)16)21(19,20)18-6-4-5-15(2,3)10-18/h7-8H,4-6,9-10H2,1-3H3 |
| InChIKey | FCAQOLKQMLQIIS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|