C14H18Cl2FNO2S — CID 81450841
1-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-3,3-dimethylpiperidine (PubChem CID 81450841) has the molecular formula C14H18Cl2FNO2S and a molecular weight of 354.27 g/mol. Its IUPAC name is 1-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-3,3-dimethylpiperidine.
| Compound Name | 1-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 81450841 |
| Molecular Formula | C14H18Cl2FNO2S |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 1-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2cc(F)c(Cl)c(CCl)c2)C1 |
| InChI | InChI=1S/C14H18Cl2FNO2S/c1-14(2)4-3-5-18(9-14)21(19,20)11-6-10(8-15)13(16)12(17)7-11/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | FKRCTTQDQIOEPE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|