C13H16Cl2FNO3S — CID 81452514
4-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-2-methyl-1,4-oxazepane (PubChem CID 81452514) has the molecular formula C13H16Cl2FNO3S and a molecular weight of 356.25 g/mol. Its IUPAC name is 4-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-2-methyl-1,4-oxazepane.
| Compound Name | 4-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-2-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 81452514 |
| Molecular Formula | C13H16Cl2FNO3S |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-[4-chloro-3-(chloromethyl)-5-fluorophenyl]sulfonyl-2-methyl-1,4-oxazepane |
| SMILES | CC1CN(S(=O)(=O)c2cc(F)c(Cl)c(CCl)c2)CCCO1 |
| InChI | InChI=1S/C13H16Cl2FNO3S/c1-9-8-17(3-2-4-20-9)21(18,19)11-5-10(7-14)13(15)12(16)6-11/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | AWEKPLBLOPSXGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|