C12H17NO4S — CID 62968856
4-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]phenol (PubChem CID 62968856) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is 4-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]phenol.
| Compound Name | 4-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]phenol |
|---|---|
| PubChem CID | 62968856 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]phenol |
| SMILES | CC1CN(S(=O)(=O)c2ccc(O)cc2)CCCO1 |
| InChI | InChI=1S/C12H17NO4S/c1-10-9-13(7-2-8-17-10)18(15,16)12-5-3-11(14)4-6-12/h3-6,10,14H,2,7-9H2,1H3 |
| InChIKey | GBUXEBKBKQSLKO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |