C10H17N5O3S — CID 62967611
[5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine (PubChem CID 62967611) has the molecular formula C10H17N5O3S and a molecular weight of 287.34 g/mol. Its IUPAC name is [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine.
| Compound Name | [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 62967611 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(NN)nc2)CCCO1 |
| InChI | InChI=1S/C10H17N5O3S/c1-8-7-15(3-2-4-18-8)19(16,17)9-5-12-10(14-11)13-6-9/h5-6,8H,2-4,7,11H2,1H3,(H,12,13,14) |
| InChIKey | GZGZGWDTXAPCCR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|