About [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine
[5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine (PubChem CID 62967611) has the molecular formula C10H17N5O3S
and a molecular weight of 287.34 g/mol. Its IUPAC name is [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine |
| PubChem CID | 62967611 |
| Molecular Formula | C10H17N5O3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine |
| SMILES | CC1CN(S(=O)(=O)c2cnc(NN)nc2)CCCO1 |
| InChI | InChI=1S/C10H17N5O3S/c1-8-7-15(3-2-4-18-8)19(16,17)9-5-12-10(14-11)13-6-9/h5-6,8H,2-4,7,11H2,1H3,(H,12,13,14) |
| InChIKey | GZGZGWDTXAPCCR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine?
The IUPAC name of [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine (CID 62967611) is [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine.
What is the SMILES notation for [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine?
The canonical SMILES for [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine is CC1CN(S(=O)(=O)c2cnc(NN)nc2)CCCO1.
What is the InChIKey of [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine?
The InChIKey is GZGZGWDTXAPCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O3S/c1-8-7-15(3-2-4-18-8)19(16,17)9-5-12-10(14-11)13-6-9/h5-6,8H,2-4,7,11H2,1H3,(H,12,13,14).
What are the key properties of [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine?
[5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine has a molecular weight of 287.34 g/mol, XLogP of -0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2-methyl-1,4-oxazepan-4-yl)sulfonyl]pyrimidin-2-yl]hydrazine is sourced from PubChem (CID 62967611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).