C11H20N6O2S — CID 63621762
[5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylpyrimidin-2-yl]hydrazine (PubChem CID 63621762) has the molecular formula C11H20N6O2S and a molecular weight of 300.39 g/mol. Its IUPAC name is [5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylpyrimidin-2-yl]hydrazine.
| Compound Name | [5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 63621762 |
| Molecular Formula | C11H20N6O2S |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [5-(3-ethyl-4-methylpiperazin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
| SMILES | CCC1CN(S(=O)(=O)c2cnc(NN)nc2)CCN1C |
| InChI | InChI=1S/C11H20N6O2S/c1-3-9-8-17(5-4-16(9)2)20(18,19)10-6-13-11(15-12)14-7-10/h6-7,9H,3-5,8,12H2,1-2H3,(H,13,14,15) |
| InChIKey | UVMFCMLKRKSLRD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|