C11H19N5O2S — CID 61329304
[5-(2-ethylpiperidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine (PubChem CID 61329304) has the molecular formula C11H19N5O2S and a molecular weight of 285.37 g/mol. Its IUPAC name is [5-(2-ethylpiperidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine.
| Compound Name | [5-(2-ethylpiperidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 61329304 |
| Molecular Formula | C11H19N5O2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [5-(2-ethylpiperidin-1-yl)sulfonylpyrimidin-2-yl]hydrazine |
| SMILES | CCC1CCCCN1S(=O)(=O)c1cnc(NN)nc1 |
| InChI | InChI=1S/C11H19N5O2S/c1-2-9-5-3-4-6-16(9)19(17,18)10-7-13-11(15-12)14-8-10/h7-9H,2-6,12H2,1H3,(H,13,14,15) |
| InChIKey | QLDZWUZABMKOEI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|