C12H19N3O3S2 — CID 27242370
N-[5-[(2S)-2-ethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-yl]acetamide (PubChem CID 27242370) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[5-[(2S)-2-ethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2S)-2-ethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 27242370 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N-[5-[(2S)-2-ethylpiperidin-1-yl]sulfonyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC[C@H]1CCCCN1S(=O)(=O)c1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-3-10-6-4-5-7-15(10)20(17,18)11-8-13-12(19-11)14-9(2)16/h8,10H,3-7H2,1-2H3,(H,13,14,16)/t10-/m0/s1 |
| InChIKey | GNCCYSVWMQGBRW-JTQLQIEISA-N |
| XLogP | 2.05 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |