C11H17BrN4O3S2 — CID 116639673
N-[5-[2-(bromomethyl)azepan-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 116639673) has the molecular formula C11H17BrN4O3S2 and a molecular weight of 397.32 g/mol. Its IUPAC name is N-[5-[2-(bromomethyl)azepan-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-(bromomethyl)azepan-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 116639673 |
| Molecular Formula | C11H17BrN4O3S2 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | N-[5-[2-(bromomethyl)azepan-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N2CCCCCC2CBr)s1 |
| InChI | InChI=1S/C11H17BrN4O3S2/c1-8(17)13-10-14-15-11(20-10)21(18,19)16-6-4-2-3-5-9(16)7-12/h9H,2-7H2,1H3,(H,13,14,17) |
| InChIKey | QEMQLQUARFIQPP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|