C10H16N4O4S2 — CID 106364604
N-[5-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 106364604) has the molecular formula C10H16N4O4S2 and a molecular weight of 320.40 g/mol. Its IUPAC name is N-[5-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 106364604 |
| Molecular Formula | C10H16N4O4S2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[5-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NC2CCCC2CO)s1 |
| InChI | InChI=1S/C10H16N4O4S2/c1-6(16)11-9-12-13-10(19-9)20(17,18)14-8-4-2-3-7(8)5-15/h7-8,14-15H,2-5H2,1H3,(H,11,12,16) |
| InChIKey | GTXOPAZYVQERGK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|