C10H17N5O3S2 — CID 114695273
N-[5-[(2-methylpiperidin-3-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 114695273) has the molecular formula C10H17N5O3S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[5-[(2-methylpiperidin-3-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(2-methylpiperidin-3-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 114695273 |
| Molecular Formula | C10H17N5O3S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[5-[(2-methylpiperidin-3-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)NC2CCCNC2C)s1 |
| InChI | InChI=1S/C10H17N5O3S2/c1-6-8(4-3-5-11-6)15-20(17,18)10-14-13-9(19-10)12-7(2)16/h6,8,11,15H,3-5H2,1-2H3,(H,12,13,16) |
| InChIKey | YDZDTRCZXRIPRJ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|