C11H16N4O3S2 — CID 125060441
N-[5-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 125060441) has the molecular formula C11H16N4O3S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[5-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 125060441 |
| Molecular Formula | C11H16N4O3S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[5-[[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N[C@H]2C[C@H]3CC[C@H]2C3)s1 |
| InChI | InChI=1S/C11H16N4O3S2/c1-6(16)12-10-13-14-11(19-10)20(17,18)15-9-5-7-2-3-8(9)4-7/h7-9,15H,2-5H2,1H3,(H,12,13,16)/t7-,8-,9-/m0/s1 |
| InChIKey | PTLFUSCQMKDKAV-CIUDSAMLSA-N |
| XLogP | 0.96 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|