C8H12N4O3S2 — CID 110726801
N-[5-[cyclopropyl(methyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110726801) has the molecular formula C8H12N4O3S2 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[5-[cyclopropyl(methyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[cyclopropyl(methyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110726801 |
| Molecular Formula | C8H12N4O3S2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | N-[5-[cyclopropyl(methyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N(C)C2CC2)s1 |
| InChI | InChI=1S/C8H12N4O3S2/c1-5(13)9-7-10-11-8(16-7)17(14,15)12(2)6-3-4-6/h6H,3-4H2,1-2H3,(H,9,10,13) |
| InChIKey | ANOPOMSKWQVSKU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|