C8H9N5O3S3 — CID 110723460
N-[5-[methyl(1,3-thiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110723460) has the molecular formula C8H9N5O3S3 and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[5-[methyl(1,3-thiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[methyl(1,3-thiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110723460 |
| Molecular Formula | C8H9N5O3S3 |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | N-[5-[methyl(1,3-thiazol-2-yl)sulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N(C)c2nccs2)s1 |
| InChI | InChI=1S/C8H9N5O3S3/c1-5(14)10-6-11-12-8(18-6)19(15,16)13(2)7-9-3-4-17-7/h3-4H,1-2H3,(H,10,11,14) |
| InChIKey | APXVIKOZZGEHEY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|