C8H12N4O4S2 — CID 110739746
N-[5-(1,3-oxazinan-3-ylsulfonyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 110739746) has the molecular formula C8H12N4O4S2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[5-(1,3-oxazinan-3-ylsulfonyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-(1,3-oxazinan-3-ylsulfonyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 110739746 |
| Molecular Formula | C8H12N4O4S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N-[5-(1,3-oxazinan-3-ylsulfonyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nnc(S(=O)(=O)N2CCCOC2)s1 |
| InChI | InChI=1S/C8H12N4O4S2/c1-6(13)9-7-10-11-8(17-7)18(14,15)12-3-2-4-16-5-12/h2-5H2,1H3,(H,9,10,13) |
| InChIKey | FUROVDZLBCSGRF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|