C13H20N4O4S2 — CID 22517558
N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)cyclohexanecarboxamide (PubChem CID 22517558) has the molecular formula C13H20N4O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 22517558 |
| Molecular Formula | C13H20N4O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)cyclohexanecarboxamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCOCC2)s1)C1CCCCC1 |
| InChI | InChI=1S/C13H20N4O4S2/c18-11(10-4-2-1-3-5-10)14-12-15-16-13(22-12)23(19,20)17-6-8-21-9-7-17/h10H,1-9H2,(H,14,15,18) |
| InChIKey | AIZJGHYVRKVLME-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|