C17H24N4O4S2 — CID 46271917
N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide (PubChem CID 46271917) has the molecular formula C17H24N4O4S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 46271917 |
| Molecular Formula | C17H24N4O4S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-(5-morpholin-4-ylsulfonyl-1,3,4-thiadiazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCOCC2)s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H24N4O4S2/c22-14(17-8-11-5-12(9-17)7-13(6-11)10-17)18-15-19-20-16(26-15)27(23,24)21-1-3-25-4-2-21/h11-13H,1-10H2,(H,18,19,22) |
| InChIKey | TVCWHQCQYLADHX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|