C22H27N3O3S2 — CID 3530771
N-(6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)adamantane-1-carboxamide (PubChem CID 3530771) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N-(6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)adamantane-1-carboxamide.
| Compound Name | N-(6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3530771 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-(6-pyrrolidin-1-ylsulfonyl-1,3-benzothiazol-2-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc2ccc(S(=O)(=O)N3CCCC3)cc2s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H27N3O3S2/c26-20(22-11-14-7-15(12-22)9-16(8-14)13-22)24-21-23-18-4-3-17(10-19(18)29-21)30(27,28)25-5-1-2-6-25/h3-4,10,14-16H,1-2,5-9,11-13H2,(H,23,24,26) |
| InChIKey | XMECYFOYYWDVGT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |