C12H14Br2ClNO2S — CID 81326731
4-chloro-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine (PubChem CID 81326731) has the molecular formula C12H14Br2ClNO2S and a molecular weight of 431.58 g/mol. Its IUPAC name is 4-chloro-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine.
| Compound Name | 4-chloro-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 81326731 |
| Molecular Formula | C12H14Br2ClNO2S |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 428.88 |
| IUPAC Name | 4-chloro-1-(2,5-dibromo-4-methylphenyl)sulfonylpiperidine |
| SMILES | Cc1cc(Br)c(S(=O)(=O)N2CCC(Cl)CC2)cc1Br |
| InChI | InChI=1S/C12H14Br2ClNO2S/c1-8-6-11(14)12(7-10(8)13)19(17,18)16-4-2-9(15)3-5-16/h6-7,9H,2-5H2,1H3 |
| InChIKey | LGMUXQYTBBTMEP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|