C12H13BrFNO — CID 63101118
1-[(4-bromo-2-fluorophenyl)methyl]-4-methylpyrrolidin-2-one (PubChem CID 63101118) has the molecular formula C12H13BrFNO and a molecular weight of 286.14 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-4-methylpyrrolidin-2-one.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 63101118 |
| Molecular Formula | C12H13BrFNO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-methylpyrrolidin-2-one |
| SMILES | CC1CC(=O)N(Cc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C12H13BrFNO/c1-8-4-12(16)15(6-8)7-9-2-3-10(13)5-11(9)14/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | GBRDLCXJCNHWQI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |