C32H40Br2F2N4O6 — CID 175880557
tert-butyl 4-[(4-bromo-2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxylate (PubChem CID 175880557) has the molecular formula C32H40Br2F2N4O6 and a molecular weight of 774.50 g/mol. Its IUPAC name is tert-butyl 4-[(4-bromo-2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-bromo-2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175880557 |
| Molecular Formula | C32H40Br2F2N4O6 |
| Molecular Weight | 774.50 g/mol |
| Exact Mass | 772.13 |
| IUPAC Name | tert-butyl 4-[(4-bromo-2-fluorophenyl)methyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(Br)cc2F)C(=O)C1.CC(C)(C)OC(=O)N1CCN(Cc2ccc(Br)cc2F)C(=O)C1 |
| InChI | InChI=1S/2C16H20BrFN2O3/c2*1-16(2,3)23-15(22)20-7-6-19(14(21)10-20)9-11-4-5-12(17)8-13(11)18/h2*4-5,8H,6-7,9-10H2,1-3H3 |
| InChIKey | GTCDWJNUXKVHRT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |