C16H21N3O5 — CID 23447601
tert-butyl 4-[(4-nitrophenyl)methyl]-3-oxopiperazine-1-carboxylate (PubChem CID 23447601) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is tert-butyl 4-[(4-nitrophenyl)methyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-nitrophenyl)methyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 23447601 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl 4-[(4-nitrophenyl)methyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc([N+](=O)[O-])cc2)C(=O)C1 |
| InChI | InChI=1S/C16H21N3O5/c1-16(2,3)24-15(21)18-9-8-17(14(20)11-18)10-12-4-6-13(7-5-12)19(22)23/h4-7H,8-11H2,1-3H3 |
| InChIKey | KIINXGFPTMRMNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|