C19H32N2O4S — CID 143596230
tert-butyl pyrrolidine-1-carboxylate;ethane;1-ethylsulfanyl-4-nitrobenzene (PubChem CID 143596230) has the molecular formula C19H32N2O4S and a molecular weight of 384.54 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;ethane;1-ethylsulfanyl-4-nitrobenzene.
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;ethane;1-ethylsulfanyl-4-nitrobenzene |
|---|---|
| PubChem CID | 143596230 |
| Molecular Formula | C19H32N2O4S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;ethane;1-ethylsulfanyl-4-nitrobenzene |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC1.CCSc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H17NO2.C8H9NO2S.C2H6/c1-9(2,3)12-8(11)10-6-4-5-7-10;1-2-12-8-5-3-7(4-6-8)9(10)11;1-2/h4-7H2,1-3H3;3-6H,2H2,1H3;1-2H3 |
| InChIKey | ISTXJNDWHSHMCD-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|