C16H24N4O5 — CID 169188280
tert-butyl 4-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]piperazine-1-carboxylate (PubChem CID 169188280) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is tert-butyl 4-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 169188280 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | tert-butyl 4-[2-[(5-nitro-2-pyridinyl)oxy]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCOc2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C16H24N4O5/c1-16(2,3)25-15(21)19-8-6-18(7-9-19)10-11-24-14-5-4-13(12-17-14)20(22)23/h4-5,12H,6-11H2,1-3H3 |
| InChIKey | IMYHHJCRYVMTQX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|