C28H44N6O6 — CID 66728670
tert-butyl 4-[4-[[5-nitro-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexanecarbonyl]piperazine-1-carboxylate (PubChem CID 66728670) has the molecular formula C28H44N6O6 and a molecular weight of 560.70 g/mol. Its IUPAC name is tert-butyl 4-[4-[[5-nitro-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexanecarbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[5-nitro-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexanecarbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 66728670 |
| Molecular Formula | C28H44N6O6 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | tert-butyl 4-[4-[[5-nitro-2-(2-piperidin-1-ylethoxy)-4-pyridinyl]amino]cyclohexanecarbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C2CCC(Nc3cc(OCCN4CCCCC4)ncc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C28H44N6O6/c1-28(2,3)40-27(36)33-15-13-32(14-16-33)26(35)21-7-9-22(10-8-21)30-23-19-25(29-20-24(23)34(37)38)39-18-17-31-11-5-4-6-12-31/h19-22H,4-18H2,1-3H3,(H,29,30) |
| InChIKey | QUSHTBZKNQAISL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|