C22H35N5O5 — CID 86692820
4-[[2-(3-morpholin-4-ylpropoxy)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 86692820) has the molecular formula C22H35N5O5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[[2-(3-morpholin-4-ylpropoxy)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[[2-(3-morpholin-4-ylpropoxy)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 86692820 |
| Molecular Formula | C22H35N5O5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | 4-[[2-(3-morpholin-4-ylpropoxy)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCC(Nc2cc(OCCCN3CCOCC3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H35N5O5/c1-16(2)24-22(28)17-4-6-18(7-5-17)25-19-14-21(23-15-20(19)27(29)30)32-11-3-8-26-9-12-31-13-10-26/h14-18H,3-13H2,1-2H3,(H,23,25)(H,24,28) |
| InChIKey | DXQIPTFABSDXRB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 118.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|