C20H32N6O5S — CID 66728470
4-[[2-(4-methylsulfonylpiperazin-1-yl)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 66728470) has the molecular formula C20H32N6O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[[2-(4-methylsulfonylpiperazin-1-yl)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 4-[[2-(4-methylsulfonylpiperazin-1-yl)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66728470 |
| Molecular Formula | C20H32N6O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | 4-[[2-(4-methylsulfonylpiperazin-1-yl)-5-nitro-4-pyridinyl]amino]-N-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC(C)NC(=O)C1CCC(Nc2cc(N3CCN(S(C)(=O)=O)CC3)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H32N6O5S/c1-14(2)22-20(27)15-4-6-16(7-5-15)23-17-12-19(21-13-18(17)26(28)29)24-8-10-25(11-9-24)32(3,30)31/h12-16H,4-11H2,1-3H3,(H,21,23)(H,22,27) |
| InChIKey | SKULUZHHQPTEEC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 137.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|