C18H25N7O4 — CID 172601792
tert-butyl N-[(1S)-3-[[5-nitro-2-(triazol-2-yl)-4-pyridinyl]amino]cyclohexyl]carbamate (PubChem CID 172601792) has the molecular formula C18H25N7O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[[5-nitro-2-(triazol-2-yl)-4-pyridinyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[[5-nitro-2-(triazol-2-yl)-4-pyridinyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 172601792 |
| Molecular Formula | C18H25N7O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | tert-butyl N-[(1S)-3-[[5-nitro-2-(triazol-2-yl)-4-pyridinyl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCC(Nc2cc(-n3nccn3)ncc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C18H25N7O4/c1-18(2,3)29-17(26)23-13-6-4-5-12(9-13)22-14-10-16(24-20-7-8-21-24)19-11-15(14)25(27)28/h7-8,10-13H,4-6,9H2,1-3H3,(H,19,22)(H,23,26)/t12?,13-/m0/s1 |
| InChIKey | BVGVMYLEQWOITC-ABLWVSNPSA-N |
| XLogP | 2.82 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|