C18H24N4O4 — CID 168826973
tert-butyl N-[(1R,3S)-3-(4-nitroindazol-1-yl)cyclohexyl]carbamate (PubChem CID 168826973) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-(4-nitroindazol-1-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-(4-nitroindazol-1-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168826973 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-(4-nitroindazol-1-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](n2ncc3c([N+](=O)[O-])cccc32)C1 |
| InChI | InChI=1S/C18H24N4O4/c1-18(2,3)26-17(23)20-12-6-4-7-13(10-12)21-15-8-5-9-16(22(24)25)14(15)11-19-21/h5,8-9,11-13H,4,6-7,10H2,1-3H3,(H,20,23)/t12-,13+/m1/s1 |
| InChIKey | PURZJYZLGKIKMR-OLZOCXBDSA-N |
| XLogP | 3.95 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|