C16H23BrN4O4 — CID 170646256
tert-butyl N-[(1R,3S)-3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclohexyl]carbamate (PubChem CID 170646256) has the molecular formula C16H23BrN4O4 and a molecular weight of 415.29 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 170646256 |
| Molecular Formula | C16H23BrN4O4 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](Nc2ncc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H23BrN4O4/c1-16(2,3)25-15(22)20-12-6-4-5-11(8-12)19-14-13(21(23)24)7-10(17)9-18-14/h7,9,11-12H,4-6,8H2,1-3H3,(H,18,19)(H,20,22)/t11-,12+/m0/s1 |
| InChIKey | SRMKFNWHFWNBDS-NWDGAFQWSA-N |
| XLogP | 4.00 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|