C20H27N5O5 — CID 172601842
tert-butyl N-[(1S,3R)-3-[[2-(4-methyl-1,3-oxazol-2-yl)-5-nitro-4-pyridinyl]amino]cyclohexyl]carbamate (PubChem CID 172601842) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[2-(4-methyl-1,3-oxazol-2-yl)-5-nitro-4-pyridinyl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[2-(4-methyl-1,3-oxazol-2-yl)-5-nitro-4-pyridinyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 172601842 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[2-(4-methyl-1,3-oxazol-2-yl)-5-nitro-4-pyridinyl]amino]cyclohexyl]carbamate |
| SMILES | Cc1coc(-c2cc(N[C@@H]3CCC[C@H](NC(=O)OC(C)(C)C)C3)c([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C20H27N5O5/c1-12-11-29-18(22-12)16-9-15(17(10-21-16)25(27)28)23-13-6-5-7-14(8-13)24-19(26)30-20(2,3)4/h9-11,13-14H,5-8H2,1-4H3,(H,21,23)(H,24,26)/t13-,14+/m1/s1 |
| InChIKey | QWVYIKALPSDZTL-KGLIPLIRSA-N |
| XLogP | 4.20 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|