C19H24N4O4 — CID 154079962
tert-butyl N-[(1R,3S)-3-[(3-nitroquinolin-4-yl)amino]cyclopentyl]carbamate (PubChem CID 154079962) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[(3-nitroquinolin-4-yl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-[(3-nitroquinolin-4-yl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 154079962 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[(3-nitroquinolin-4-yl)amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H](Nc2c([N+](=O)[O-])cnc3ccccc23)C1 |
| InChI | InChI=1S/C19H24N4O4/c1-19(2,3)27-18(24)22-13-9-8-12(10-13)21-17-14-6-4-5-7-15(14)20-11-16(17)23(25)26/h4-7,11-13H,8-10H2,1-3H3,(H,20,21)(H,22,24)/t12-,13+/m0/s1 |
| InChIKey | RCDYZFLXBBCTRF-QWHCGFSZSA-N |
| XLogP | 4.00 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|