C11H13BrN4O4 — CID 68730858
4-[(5-bromo-3-nitro-2-pyridinyl)amino]piperidine-1-carboxylic acid (PubChem CID 68730858) has the molecular formula C11H13BrN4O4 and a molecular weight of 345.15 g/mol. Its IUPAC name is 4-[(5-bromo-3-nitro-2-pyridinyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(5-bromo-3-nitro-2-pyridinyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68730858 |
| Molecular Formula | C11H13BrN4O4 |
| Molecular Weight | 345.15 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 4-[(5-bromo-3-nitro-2-pyridinyl)amino]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(Nc2ncc(Br)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C11H13BrN4O4/c12-7-5-9(16(19)20)10(13-6-7)14-8-1-3-15(4-2-8)11(17)18/h5-6,8H,1-4H2,(H,13,14)(H,17,18) |
| InChIKey | SIARMCBGYZGKSG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.15 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|