C15H19BrN4O4 — CID 122061191
2-[[3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclobutyl]-(cyclopropylmethyl)amino]acetic acid (PubChem CID 122061191) has the molecular formula C15H19BrN4O4 and a molecular weight of 399.25 g/mol. Its IUPAC name is 2-[[3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclobutyl]-(cyclopropylmethyl)amino]acetic acid.
| Compound Name | 2-[[3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclobutyl]-(cyclopropylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 122061191 |
| Molecular Formula | C15H19BrN4O4 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 2-[[3-[(5-bromo-3-nitro-2-pyridinyl)amino]cyclobutyl]-(cyclopropylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CC1)C1CC(Nc2ncc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C15H19BrN4O4/c16-10-3-13(20(23)24)15(17-6-10)18-11-4-12(5-11)19(8-14(21)22)7-9-1-2-9/h3,6,9,11-12H,1-2,4-5,7-8H2,(H,17,18)(H,21,22) |
| InChIKey | JYNUJHASJWQZNJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|