C19H25N3O5 — CID 168799328
tert-butyl N-[(1R,3S)-3-(5-nitro-3-oxo-1H-isoindol-2-yl)cyclohexyl]carbamate (PubChem CID 168799328) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-(5-nitro-3-oxo-1H-isoindol-2-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S)-3-(5-nitro-3-oxo-1H-isoindol-2-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 168799328 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-(5-nitro-3-oxo-1H-isoindol-2-yl)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](N2Cc3ccc([N+](=O)[O-])cc3C2=O)C1 |
| InChI | InChI=1S/C19H25N3O5/c1-19(2,3)27-18(24)20-13-5-4-6-14(9-13)21-11-12-7-8-15(22(25)26)10-16(12)17(21)23/h7-8,10,13-14H,4-6,9,11H2,1-3H3,(H,20,24)/t13-,14+/m1/s1 |
| InChIKey | GBISBRDFKGWNPA-KGLIPLIRSA-N |
| XLogP | 3.39 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|