C36H59N7O10 — CID 58865586
tert-butyl N-[1-[3-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-5-nitrophenyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate (PubChem CID 58865586) has the molecular formula C36H59N7O10 and a molecular weight of 749.91 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-5-nitrophenyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-5-nitrophenyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58865586 |
| Molecular Formula | C36H59N7O10 |
| Molecular Weight | 749.91 g/mol |
| Exact Mass | 749.43 |
| IUPAC Name | tert-butyl N-[1-[3-[3,5-bis[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-5-nitrophenyl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NC(=O)OC(C)(C)C)CN(c2cc(N3CC(NC(=O)OC(C)(C)C)CC(NC(=O)OC(C)(C)C)C3)cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C36H59N7O10/c1-33(2,3)50-29(44)37-22-13-23(38-30(45)51-34(4,5)6)19-41(18-22)26-15-27(17-28(16-26)43(48)49)42-20-24(39-31(46)52-35(7,8)9)14-25(21-42)40-32(47)53-36(10,11)12/h15-17,22-25H,13-14,18-21H2,1-12H3,(H,37,44)(H,38,45)(H,39,46)(H,40,47) |
| InChIKey | PBXPXSBCKQQZGI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 202.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.91 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|