C15H19N3O5 — CID 156663121
tert-butyl N-[1-(3-nitrophenyl)-5-oxopyrrolidin-3-yl]carbamate (PubChem CID 156663121) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is tert-butyl N-[1-(3-nitrophenyl)-5-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-nitrophenyl)-5-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 156663121 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | tert-butyl N-[1-(3-nitrophenyl)-5-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C15H19N3O5/c1-15(2,3)23-14(20)16-10-7-13(19)17(9-10)11-5-4-6-12(8-11)18(21)22/h4-6,8,10H,7,9H2,1-3H3,(H,16,20) |
| InChIKey | FOFLQJNERJAFPB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|