C11H9N2O5- — CID 6926305
(3R)-1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 6926305) has the molecular formula C11H9N2O5- and a molecular weight of 249.20 g/mol. Its IUPAC name is (3R)-1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3R)-1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 6926305 |
| Molecular Formula | C11H9N2O5- |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | (3R)-1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C([O-])[C@@H]1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C11H10N2O5/c14-10-4-7(11(15)16)6-12(10)8-2-1-3-9(5-8)13(17)18/h1-3,5,7H,4,6H2,(H,15,16)/p-1/t7-/m1/s1 |
| InChIKey | HKWNCNVBEVINPC-SSDOTTSWSA-M |
| XLogP | -0.30 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|