C12H12NO3S- — CID 2433248
(3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 2433248) has the molecular formula C12H12NO3S- and a molecular weight of 250.30 g/mol. Its IUPAC name is (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2433248 |
| Molecular Formula | C12H12NO3S- |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CSc1cccc(N2C[C@@H](C(=O)[O-])CC2=O)c1 |
| InChI | InChI=1S/C12H13NO3S/c1-17-10-4-2-3-9(6-10)13-7-8(12(15)16)5-11(13)14/h2-4,6,8H,5,7H2,1H3,(H,15,16)/p-1/t8-/m0/s1 |
| InChIKey | NHDHIMKQGYJLII-QMMMGPOBSA-M |
| XLogP | 0.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |