C15H16N2O3S — CID 7892028
[(1R)-1-cyanoethyl] (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7892028) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [(1R)-1-cyanoethyl] (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7892028 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [(1R)-1-cyanoethyl] (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CSc1cccc(N2C[C@@H](C(=O)O[C@H](C)C#N)CC2=O)c1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10(8-16)20-15(19)11-6-14(18)17(9-11)12-4-3-5-13(7-12)21-2/h3-5,7,10-11H,6,9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | SPOGZKCWGPREBA-MNOVXSKESA-N |
| XLogP | 2.22 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |