C16H18N2O4 — CID 29389263
[(1S)-1-cyanoethyl] (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 29389263) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [(1S)-1-cyanoethyl] (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 29389263 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [(1S)-1-cyanoethyl] (3R)-1-(4-ethoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc(N2C[C@H](C(=O)O[C@@H](C)C#N)CC2=O)cc1 |
| InChI | InChI=1S/C16H18N2O4/c1-3-21-14-6-4-13(5-7-14)18-10-12(8-15(18)19)16(20)22-11(2)9-17/h4-7,11-12H,3,8,10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | PHLUTWJSTUEOCN-NWDGAFQWSA-N |
| XLogP | 1.89 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |