C20H19NO4S — CID 7892342
phenacyl (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7892342) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is phenacyl (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | phenacyl (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7892342 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | phenacyl (3S)-1-(3-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CSc1cccc(N2C[C@@H](C(=O)OCC(=O)c3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C20H19NO4S/c1-26-17-9-5-8-16(11-17)21-12-15(10-19(21)23)20(24)25-13-18(22)14-6-3-2-4-7-14/h2-9,11,15H,10,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | YZRYMDXFGSXDQG-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |