C12H12Cl2N2O6S — CID 162016145
methyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate;thionyl dichloride (PubChem CID 162016145) has the molecular formula C12H12Cl2N2O6S and a molecular weight of 383.21 g/mol. Its IUPAC name is methyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate;thionyl dichloride.
| Compound Name | methyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate;thionyl dichloride |
|---|---|
| PubChem CID | 162016145 |
| Molecular Formula | C12H12Cl2N2O6S |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | methyl 1-(3-nitrophenyl)-5-oxopyrrolidine-3-carboxylate;thionyl dichloride |
| SMILES | COC(=O)C1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1.O=S(Cl)Cl |
| InChI | InChI=1S/C12H12N2O5.Cl2OS/c1-19-12(16)8-5-11(15)13(7-8)9-3-2-4-10(6-9)14(17)18;1-4(2)3/h2-4,6,8H,5,7H2,1H3; |
| InChIKey | YUDANSWCWALHCK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|