C23H26N4O6 — CID 55742975
1-(3,4-dimethoxyphenyl)-4-[4-(3-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 55742975) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-[4-(3-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-[4-(3-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 55742975 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-[4-(3-nitrophenyl)piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | COc1ccc(N2CC(C(=O)N3CCN(c4cccc([N+](=O)[O-])c4)CC3)CC2=O)cc1OC |
| InChI | InChI=1S/C23H26N4O6/c1-32-20-7-6-18(14-21(20)33-2)26-15-16(12-22(26)28)23(29)25-10-8-24(9-11-25)17-4-3-5-19(13-17)27(30)31/h3-7,13-14,16H,8-12,15H2,1-2H3 |
| InChIKey | OFGLIBUPBNJDJZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|