C22H31N3O8 — CID 143194029
[(1S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 3-nitrobenzoate (PubChem CID 143194029) has the molecular formula C22H31N3O8 and a molecular weight of 465.50 g/mol. Its IUPAC name is [(1S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 3-nitrobenzoate.
| Compound Name | [(1S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 143194029 |
| Molecular Formula | C22H31N3O8 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | [(1S)-2,4-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 3-nitrobenzoate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NC(=O)OC(C)(C)C)[C@@H](OC(=O)c2cccc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C22H31N3O8/c1-21(2,3)32-19(27)23-14-11-16(24-20(28)33-22(4,5)6)17(12-14)31-18(26)13-8-7-9-15(10-13)25(29)30/h7-10,14,16-17H,11-12H2,1-6H3,(H,23,27)(H,24,28)/t14?,16?,17-/m0/s1 |
| InChIKey | ZOHZKCNHULVBHG-PREGVCBESA-N |
| XLogP | 3.70 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|