C19H20N4O6 — CID 27662819
tert-butyl N-[3-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl]carbamate (PubChem CID 27662819) has the molecular formula C19H20N4O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is tert-butyl N-[3-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 27662819 |
| Molecular Formula | C19H20N4O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | tert-butyl N-[3-[[(3-nitrobenzoyl)amino]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H20N4O6/c1-19(2,3)29-18(26)20-14-8-4-6-12(10-14)16(24)21-22-17(25)13-7-5-9-15(11-13)23(27)28/h4-11H,1-3H3,(H,20,26)(H,21,24)(H,22,25) |
| InChIKey | ZNTJWZJSWFZQLZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 139.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|