C21H21N5O5 — CID 47089411
tert-butyl N-[3-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]carbamate (PubChem CID 47089411) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 47089411 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | tert-butyl N-[3-[[5-(3-nitrophenyl)-1H-pyrazol-3-yl]carbamoyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(C(=O)Nc2cc(-c3cccc([N+](=O)[O-])c3)[nH]n2)c1 |
| InChI | InChI=1S/C21H21N5O5/c1-21(2,3)31-20(28)22-15-8-4-7-14(10-15)19(27)23-18-12-17(24-25-18)13-6-5-9-16(11-13)26(29)30/h4-12H,1-3H3,(H,22,28)(H2,23,24,25,27) |
| InChIKey | KJYCOFYFSGRLGE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|