C20H26N2O8 — CID 170580589
[(1R)-4-ethoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-nitrobenzoate (PubChem CID 170580589) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is [(1R)-4-ethoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-nitrobenzoate.
| Compound Name | [(1R)-4-ethoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 170580589 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(1R)-4-ethoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-nitrobenzoate |
| SMILES | CCOC(=O)C1CC(NC(=O)OC(C)(C)C)[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H26N2O8/c1-5-28-17(23)13-10-15(21-19(25)30-20(2,3)4)16(11-13)29-18(24)12-6-8-14(9-7-12)22(26)27/h6-9,13,15-16H,5,10-11H2,1-4H3,(H,21,25)/t13?,15?,16-/m1/s1 |
| InChIKey | TVKIRSOFXNGRFK-AVVWSFFYSA-N |
| XLogP | 2.99 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|